C20H15Br2Cl2NO3S — CID 126073404
(5Z)-5-[[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione (PubChem CID 126073404) has the molecular formula C20H15Br2Cl2NO3S and a molecular weight of 580.13 g/mol. Its IUPAC name is (5Z)-5-[[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126073404 |
| Molecular Formula | C20H15Br2Cl2NO3S |
| Molecular Weight | 580.13 g/mol |
| Exact Mass | 576.85 |
| IUPAC Name | (5Z)-5-[[3,5-dibromo-4-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)S/C(=C\c2cc(Br)c(OCc3ccc(Cl)c(Cl)c3)c(Br)c2)C1=O |
| InChI | InChI=1S/C20H15Br2Cl2NO3S/c1-10(2)25-19(26)17(29-20(25)27)8-12-5-13(21)18(14(22)6-12)28-9-11-3-4-15(23)16(24)7-11/h3-8,10H,9H2,1-2H3/b17-8- |
| InChIKey | IUYQQTFKKZYQMV-IUXPMGMMSA-N |
| XLogP | 7.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.13 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|