C24H19Br2NO3S — CID 126030378
(5E)-5-[[3,5-dibromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione (PubChem CID 126030378) has the molecular formula C24H19Br2NO3S and a molecular weight of 561.30 g/mol. Its IUPAC name is (5E)-5-[[3,5-dibromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3,5-dibromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126030378 |
| Molecular Formula | C24H19Br2NO3S |
| Molecular Weight | 561.30 g/mol |
| Exact Mass | 558.95 |
| IUPAC Name | (5E)-5-[[3,5-dibromo-4-(naphthalen-2-ylmethoxy)phenyl]methylidene]-3-propan-2-yl-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)S/C(=C/c2cc(Br)c(OCc3ccc4ccccc4c3)c(Br)c2)C1=O |
| InChI | InChI=1S/C24H19Br2NO3S/c1-14(2)27-23(28)21(31-24(27)29)12-16-10-19(25)22(20(26)11-16)30-13-15-7-8-17-5-3-4-6-18(17)9-15/h3-12,14H,13H2,1-2H3/b21-12+ |
| InChIKey | QCCHNYKNERKBML-CIAFOILYSA-N |
| XLogP | 7.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.30 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|