C21H19ClFN5O2 — CID 126069835
N-[(E)-[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]-2-(3,4-dimethylanilino)acetamide (PubChem CID 126069835) has the molecular formula C21H19ClFN5O2 and a molecular weight of 427.87 g/mol. Its IUPAC name is N-[(E)-[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]-2-(3,4-dimethylanilino)acetamide.
| Compound Name | N-[(E)-[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]-2-(3,4-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 126069835 |
| Molecular Formula | C21H19ClFN5O2 |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-[(E)-[3-(2-chloro-5-fluoropyrimidin-4-yl)oxyphenyl]methylideneamino]-2-(3,4-dimethylanilino)acetamide |
| SMILES | Cc1ccc(NCC(=O)N/N=C/c2cccc(Oc3nc(Cl)ncc3F)c2)cc1C |
| InChI | InChI=1S/C21H19ClFN5O2/c1-13-6-7-16(8-14(13)2)24-12-19(29)28-26-10-15-4-3-5-17(9-15)30-20-18(23)11-25-21(22)27-20/h3-11,24H,12H2,1-2H3,(H,28,29)/b26-10+ |
| InChIKey | LAOUTJWEVBDOOY-NSKAYECMSA-N |
| XLogP | 4.24 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|