C24H18ClFN4O3 — CID 6884079
N-[(E)-[3-(2-chloro-5-fluoropyrimidin-4-yl)oxy-4-methoxyphenyl]methylideneamino]-2-naphthalen-1-ylacetamide (PubChem CID 6884079) has the molecular formula C24H18ClFN4O3 and a molecular weight of 464.88 g/mol. Its IUPAC name is N-[(E)-[3-(2-chloro-5-fluoropyrimidin-4-yl)oxy-4-methoxyphenyl]methylideneamino]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(E)-[3-(2-chloro-5-fluoropyrimidin-4-yl)oxy-4-methoxyphenyl]methylideneamino]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 6884079 |
| Molecular Formula | C24H18ClFN4O3 |
| Molecular Weight | 464.88 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | N-[(E)-[3-(2-chloro-5-fluoropyrimidin-4-yl)oxy-4-methoxyphenyl]methylideneamino]-2-naphthalen-1-ylacetamide |
| SMILES | COc1ccc(/C=N/NC(=O)Cc2cccc3ccccc23)cc1Oc1nc(Cl)ncc1F |
| InChI | InChI=1S/C24H18ClFN4O3/c1-32-20-10-9-15(11-21(20)33-23-19(26)14-27-24(25)29-23)13-28-30-22(31)12-17-7-4-6-16-5-2-3-8-18(16)17/h2-11,13-14H,12H2,1H3,(H,30,31)/b28-13+ |
| InChIKey | YVTLEPZAGIJILK-XODNFHPESA-N |
| XLogP | 4.92 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.88 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|