C14H13ClFN5O2S — CID 91970110
[[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]methylideneamino]thiourea (PubChem CID 91970110) has the molecular formula C14H13ClFN5O2S and a molecular weight of 369.81 g/mol. Its IUPAC name is [[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]methylideneamino]thiourea.
| Compound Name | [[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 91970110 |
| Molecular Formula | C14H13ClFN5O2S |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | [[4-(2-chloro-5-fluoropyrimidin-4-yl)oxy-3-ethoxyphenyl]methylideneamino]thiourea |
| SMILES | CCOc1cc(C=NNC(N)=S)ccc1Oc1nc(Cl)ncc1F |
| InChI | InChI=1S/C14H13ClFN5O2S/c1-2-22-11-5-8(6-19-21-14(17)24)3-4-10(11)23-12-9(16)7-18-13(15)20-12/h3-7H,2H2,1H3,(H3,17,21,24) |
| InChIKey | ZUKZLORLVDSFJJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|