C26H22FN3O5 — CID 126073693
2-[2-[(E)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-methoxyphenoxy]-N-phenylacetamide (PubChem CID 126073693) has the molecular formula C26H22FN3O5 and a molecular weight of 475.48 g/mol. Its IUPAC name is 2-[2-[(E)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-methoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-[(E)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-methoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126073693 |
| Molecular Formula | C26H22FN3O5 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-[2-[(E)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-methoxyphenoxy]-N-phenylacetamide |
| SMILES | COc1cccc(/C=C2/NC(=O)N(Cc3ccccc3F)C2=O)c1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H22FN3O5/c1-34-22-13-7-9-17(24(22)35-16-23(31)28-19-10-3-2-4-11-19)14-21-25(32)30(26(33)29-21)15-18-8-5-6-12-20(18)27/h2-14H,15-16H2,1H3,(H,28,31)(H,29,33)/b21-14+ |
| InChIKey | QEQUNTXBENYAJV-KGENOOAVSA-N |
| XLogP | 3.94 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|