C27H24FN3O4 — CID 126384145
N-(3,4-dimethylphenyl)-2-[3-[(Z)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetamide (PubChem CID 126384145) has the molecular formula C27H24FN3O4 and a molecular weight of 473.50 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[3-[(Z)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[3-[(Z)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126384145 |
| Molecular Formula | C27H24FN3O4 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[3-[(Z)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2cccc(/C=C3\NC(=O)N(Cc4ccccc4F)C3=O)c2)cc1C |
| InChI | InChI=1S/C27H24FN3O4/c1-17-10-11-21(12-18(17)2)29-25(32)16-35-22-8-5-6-19(13-22)14-24-26(33)31(27(34)30-24)15-20-7-3-4-9-23(20)28/h3-14H,15-16H2,1-2H3,(H,29,32)(H,30,34)/b24-14- |
| InChIKey | XVGFPQFCUIQTFL-OYKKKHCWSA-N |
| XLogP | 4.55 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|