C16H16FN5O2 — CID 126074663
N-[(Z)-(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-5-nitropyridin-2-amine (PubChem CID 126074663) has the molecular formula C16H16FN5O2 and a molecular weight of 329.34 g/mol. Its IUPAC name is N-[(Z)-(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-5-nitropyridin-2-amine.
| Compound Name | N-[(Z)-(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 126074663 |
| Molecular Formula | C16H16FN5O2 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[(Z)-(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-5-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(N/N=C\c2ccc(N3CCCC3)c(F)c2)nc1 |
| InChI | InChI=1S/C16H16FN5O2/c17-14-9-12(3-5-15(14)21-7-1-2-8-21)10-19-20-16-6-4-13(11-18-16)22(23)24/h3-6,9-11H,1-2,7-8H2,(H,18,20)/b19-10- |
| InChIKey | IJQFDOHPPWMYDB-GRSHGNNSSA-N |
| XLogP | 3.18 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|