C14H11Br2NO5S — CID 126078045
methyl (2R)-2-[(5E)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126078045) has the molecular formula C14H11Br2NO5S and a molecular weight of 465.12 g/mol. Its IUPAC name is methyl (2R)-2-[(5E)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2R)-2-[(5E)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126078045 |
| Molecular Formula | C14H11Br2NO5S |
| Molecular Weight | 465.12 g/mol |
| Exact Mass | 462.87 |
| IUPAC Name | methyl (2R)-2-[(5E)-5-[(3,5-dibromo-2-hydroxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)N1C(=O)S/C(=C/c2cc(Br)cc(Br)c2O)C1=O |
| InChI | InChI=1S/C14H11Br2NO5S/c1-6(13(20)22-2)17-12(19)10(23-14(17)21)4-7-3-8(15)5-9(16)11(7)18/h3-6,18H,1-2H3/b10-4+/t6-/m1/s1 |
| InChIKey | PLYXKPVKHAHYQA-KIUQOZPWSA-N |
| XLogP | 3.52 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|