C18H20BrNO6S — CID 1308470
methyl (2S)-2-[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 1308470) has the molecular formula C18H20BrNO6S and a molecular weight of 458.33 g/mol. Its IUPAC name is methyl (2S)-2-[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl (2S)-2-[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 1308470 |
| Molecular Formula | C18H20BrNO6S |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | methyl (2S)-2-[(5E)-5-[(5-bromo-2,4-diethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOc1cc(OCC)c(/C=C2/SC(=O)N([C@@H](C)C(=O)OC)C2=O)cc1Br |
| InChI | InChI=1S/C18H20BrNO6S/c1-5-25-13-9-14(26-6-2)12(19)7-11(13)8-15-16(21)20(18(23)27-15)10(3)17(22)24-4/h7-10H,5-6H2,1-4H3/b15-8+/t10-/m0/s1 |
| InChIKey | GQJGHMKOAAHQIP-CYANDVJASA-N |
| XLogP | 3.84 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|