C33H33N3O6S — CID 126093474
ethyl (2E,5S)-2-[[5-(1-adamantyl)-2-hydroxyphenyl]methylidene]-7-methyl-5-(3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126093474) has the molecular formula C33H33N3O6S and a molecular weight of 599.71 g/mol. Its IUPAC name is ethyl (2E,5S)-2-[[5-(1-adamantyl)-2-hydroxyphenyl]methylidene]-7-methyl-5-(3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2E,5S)-2-[[5-(1-adamantyl)-2-hydroxyphenyl]methylidene]-7-methyl-5-(3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126093474 |
| Molecular Formula | C33H33N3O6S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | ethyl (2E,5S)-2-[[5-(1-adamantyl)-2-hydroxyphenyl]methylidene]-7-methyl-5-(3-nitrophenyl)-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2s/c(=C/c3cc(C45CC6CC(CC(C6)C4)C5)ccc3O)c(=O)n2[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H33N3O6S/c1-3-42-31(39)28-18(2)34-32-35(29(28)22-5-4-6-25(13-22)36(40)41)30(38)27(43-32)14-23-12-24(7-8-26(23)37)33-15-19-9-20(16-33)11-21(10-19)17-33/h4-8,12-14,19-21,29,37H,3,9-11,15-17H2,1-2H3/b27-14+/t19?,20?,21?,29-,33?/m0/s1 |
| InChIKey | AQBVJRDLSZEYDX-QOUGJOIHSA-N |
| XLogP | 4.88 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|