C19H21N3S — CID 126094737
3-benzyl-4-(3,4-dimethylphenyl)-5-ethylsulfanyl-1,2,4-triazole (PubChem CID 126094737) has the molecular formula C19H21N3S and a molecular weight of 323.47 g/mol. Its IUPAC name is 3-benzyl-4-(3,4-dimethylphenyl)-5-ethylsulfanyl-1,2,4-triazole.
| Compound Name | 3-benzyl-4-(3,4-dimethylphenyl)-5-ethylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 126094737 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3-benzyl-4-(3,4-dimethylphenyl)-5-ethylsulfanyl-1,2,4-triazole |
| SMILES | CCSc1nnc(Cc2ccccc2)n1-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H21N3S/c1-4-23-19-21-20-18(13-16-8-6-5-7-9-16)22(19)17-11-10-14(2)15(3)12-17/h5-12H,4,13H2,1-3H3 |
| InChIKey | LIHDZGGWMCBZFA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |