C34H38N2O2S — CID 126095074
(6R)-2-[(2-butoxynaphthalen-1-yl)methylideneamino]-6-tert-butyl-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126095074) has the molecular formula C34H38N2O2S and a molecular weight of 538.76 g/mol. Its IUPAC name is (6R)-2-[(2-butoxynaphthalen-1-yl)methylideneamino]-6-tert-butyl-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-2-[(2-butoxynaphthalen-1-yl)methylideneamino]-6-tert-butyl-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126095074 |
| Molecular Formula | C34H38N2O2S |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | (6R)-2-[(2-butoxynaphthalen-1-yl)methylideneamino]-6-tert-butyl-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCCCOc1ccc2ccccc2c1C=Nc1sc2c(c1C(=O)Nc1ccccc1)CC[C@@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C34H38N2O2S/c1-5-6-20-38-29-19-16-23-12-10-11-15-26(23)28(29)22-35-33-31(32(37)36-25-13-8-7-9-14-25)27-18-17-24(34(2,3)4)21-30(27)39-33/h7-16,19,22,24H,5-6,17-18,20-21H2,1-4H3,(H,36,37)/t24-/m1/s1 |
| InChIKey | XOZSIANYPCURBJ-XMMPIXPASA-N |
| XLogP | 9.23 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|