C34H31Cl2I2N3O5S — CID 126095505
(2E,5R)-2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126095505) has the molecular formula C34H31Cl2I2N3O5S and a molecular weight of 918.42 g/mol. Its IUPAC name is (2E,5R)-2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5R)-2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126095505 |
| Molecular Formula | C34H31Cl2I2N3O5S |
| Molecular Weight | 918.42 g/mol |
| Exact Mass | 916.95 |
| IUPAC Name | (2E,5R)-2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C/c3cc(I)c(OCc4ccc(Cl)cc4Cl)c(I)c3)c(=O)n2[C@@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C34H31Cl2I2N3O5S/c1-6-40(7-2)33(43)29-18(3)39-34-41(30(29)23-16-22(44-4)10-11-27(23)45-5)32(42)28(47-34)14-19-12-25(37)31(26(38)13-19)46-17-20-8-9-21(35)15-24(20)36/h8-16,30H,6-7,17H2,1-5H3/b28-14+/t30-/m1/s1 |
| InChIKey | NGLBIGBIHMOFNE-CDWRSTBESA-N |
| XLogP | 7.22 |
| TPSA | 82.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.42 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|