C16H18ClNO3S — CID 126103457
(5E)-3-[(2R)-butan-2-yl]-5-[(5-chloro-2-ethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126103457) has the molecular formula C16H18ClNO3S and a molecular weight of 339.84 g/mol. Its IUPAC name is (5E)-3-[(2R)-butan-2-yl]-5-[(5-chloro-2-ethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2R)-butan-2-yl]-5-[(5-chloro-2-ethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126103457 |
| Molecular Formula | C16H18ClNO3S |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | (5E)-3-[(2R)-butan-2-yl]-5-[(5-chloro-2-ethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1ccc(Cl)cc1/C=C1/SC(=O)N([C@H](C)CC)C1=O |
| InChI | InChI=1S/C16H18ClNO3S/c1-4-10(3)18-15(19)14(22-16(18)20)9-11-8-12(17)6-7-13(11)21-5-2/h6-10H,4-5H2,1-3H3/b14-9+/t10-/m1/s1 |
| InChIKey | LMIMNZOACZOIPZ-GMROUXNLSA-N |
| XLogP | 4.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|