C16H18BrNO4S — CID 126021649
(5E)-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-[(2S)-butan-2-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 126021649) has the molecular formula C16H18BrNO4S and a molecular weight of 400.29 g/mol. Its IUPAC name is (5E)-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-[(2S)-butan-2-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-[(2S)-butan-2-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126021649 |
| Molecular Formula | C16H18BrNO4S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | (5E)-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-3-[(2S)-butan-2-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC[C@H](C)N1C(=O)S/C(=C/c2cc(Br)c(OC)cc2OC)C1=O |
| InChI | InChI=1S/C16H18BrNO4S/c1-5-9(2)18-15(19)14(23-16(18)20)7-10-6-11(17)13(22-4)8-12(10)21-3/h6-9H,5H2,1-4H3/b14-7+/t9-/m0/s1 |
| InChIKey | ADCMNPQLTVGILW-DUJAKZANSA-N |
| XLogP | 4.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|