C19H24BrNO4S — CID 126016700
(5E)-5-[[3-bromo-4-[(2R)-butan-2-yl]oxy-5-methoxyphenyl]methylidene]-3-[(2S)-butan-2-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 126016700) has the molecular formula C19H24BrNO4S and a molecular weight of 442.38 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[(2R)-butan-2-yl]oxy-5-methoxyphenyl]methylidene]-3-[(2S)-butan-2-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-4-[(2R)-butan-2-yl]oxy-5-methoxyphenyl]methylidene]-3-[(2S)-butan-2-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126016700 |
| Molecular Formula | C19H24BrNO4S |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[(2R)-butan-2-yl]oxy-5-methoxyphenyl]methylidene]-3-[(2S)-butan-2-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC[C@@H](C)Oc1c(Br)cc(/C=C2/SC(=O)N([C@@H](C)CC)C2=O)cc1OC |
| InChI | InChI=1S/C19H24BrNO4S/c1-6-11(3)21-18(22)16(26-19(21)23)10-13-8-14(20)17(15(9-13)24-5)25-12(4)7-2/h8-12H,6-7H2,1-5H3/b16-10+/t11-,12+/m0/s1 |
| InChIKey | DJGJVWYWKOYTCY-AWOYWQDDSA-N |
| XLogP | 5.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|