C18H22BrNO4S — CID 126018414
(5E)-5-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-3-[(2R)-butan-2-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 126018414) has the molecular formula C18H22BrNO4S and a molecular weight of 428.35 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-3-[(2R)-butan-2-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-3-[(2R)-butan-2-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126018414 |
| Molecular Formula | C18H22BrNO4S |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | (5E)-5-[(3-bromo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]-3-[(2R)-butan-2-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC[C@@H](C)N1C(=O)S/C(=C/c2cc(Br)c(OC(C)C)c(OC)c2)C1=O |
| InChI | InChI=1S/C18H22BrNO4S/c1-6-11(4)20-17(21)15(25-18(20)22)9-12-7-13(19)16(24-10(2)3)14(8-12)23-5/h7-11H,6H2,1-5H3/b15-9+/t11-/m1/s1 |
| InChIKey | HZXWWTSRWIZFGR-BTAWCLGRSA-N |
| XLogP | 5.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|