C17H21NO5S — CID 6372764
(5Z)-3-butan-2-yl-5-[(2,4,6-trimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 6372764) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is (5Z)-3-butan-2-yl-5-[(2,4,6-trimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-butan-2-yl-5-[(2,4,6-trimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6372764 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (5Z)-3-butan-2-yl-5-[(2,4,6-trimethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCC(C)N1C(=O)S/C(=C\c2c(OC)cc(OC)cc2OC)C1=O |
| InChI | InChI=1S/C17H21NO5S/c1-6-10(2)18-16(19)15(24-17(18)20)9-12-13(22-4)7-11(21-3)8-14(12)23-5/h7-10H,6H2,1-5H3/b15-9- |
| InChIKey | DJSFWZIDAWQULR-DHDCSXOGSA-N |
| XLogP | 3.55 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|