C25H19ClN2O4S2 — CID 126109684
(5Z)-5-[[2-(4-chlorophenyl)sulfanylphenyl]methylidene]-1-(2,4-dimethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126109684) has the molecular formula C25H19ClN2O4S2 and a molecular weight of 511.02 g/mol. Its IUPAC name is (5Z)-5-[[2-(4-chlorophenyl)sulfanylphenyl]methylidene]-1-(2,4-dimethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5Z)-5-[[2-(4-chlorophenyl)sulfanylphenyl]methylidene]-1-(2,4-dimethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126109684 |
| Molecular Formula | C25H19ClN2O4S2 |
| Molecular Weight | 511.02 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | (5Z)-5-[[2-(4-chlorophenyl)sulfanylphenyl]methylidene]-1-(2,4-dimethoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1ccc(N2C(=O)/C(=C\c3ccccc3Sc3ccc(Cl)cc3)C(=O)NC2=S)c(OC)c1 |
| InChI | InChI=1S/C25H19ClN2O4S2/c1-31-17-9-12-20(21(14-17)32-2)28-24(30)19(23(29)27-25(28)33)13-15-5-3-4-6-22(15)34-18-10-7-16(26)8-11-18/h3-14H,1-2H3,(H,27,29,33)/b19-13- |
| InChIKey | WDOUYTFGDPRIAS-UYRXBGFRSA-N |
| XLogP | 5.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.02 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|