C24H22N4O3 — CID 126110470
N-(3-methylphenyl)-2-[(4E)-4-[[1-(2-methylphenyl)pyrrol-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 126110470) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[(4E)-4-[[1-(2-methylphenyl)pyrrol-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[(4E)-4-[[1-(2-methylphenyl)pyrrol-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 126110470 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-(3-methylphenyl)-2-[(4E)-4-[[1-(2-methylphenyl)pyrrol-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)N/C(=C/c3cccn3-c3ccccc3C)C2=O)c1 |
| InChI | InChI=1S/C24H22N4O3/c1-16-7-5-9-18(13-16)25-22(29)15-28-23(30)20(26-24(28)31)14-19-10-6-12-27(19)21-11-4-3-8-17(21)2/h3-14H,15H2,1-2H3,(H,25,29)(H,26,31)/b20-14+ |
| InChIKey | DZVQOGVCPVKICU-XSFVSMFZSA-N |
| XLogP | 3.63 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|