C8H6O5 — CID 12611561
7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid (PubChem CID 12611561) has the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. Its IUPAC name is 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid.
| Compound Name | 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 12611561 |
| Molecular Formula | C8H6O5 |
| Molecular Weight | 182.13 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylic acid |
| SMILES | O=C(O)C1=C(C(=O)O)C2C=CC1O2 |
| InChI | InChI=1S/C8H6O5/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12/h1-4H,(H,9,10)(H,11,12) |
| InChIKey | AISJHDVIGHZXAK-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.13 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|