C19H21N3O5S — CID 126122923
N-[(Z)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-4-[methyl(methylsulfonyl)amino]benzamide (PubChem CID 126122923) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is N-[(Z)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-4-[methyl(methylsulfonyl)amino]benzamide.
| Compound Name | N-[(Z)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-4-[methyl(methylsulfonyl)amino]benzamide |
|---|---|
| PubChem CID | 126122923 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[(Z)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-4-[methyl(methylsulfonyl)amino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(N(C)S(C)(=O)=O)cc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H21N3O5S/c1-13(15-6-9-17-18(12-15)27-11-10-26-17)20-21-19(23)14-4-7-16(8-5-14)22(2)28(3,24)25/h4-9,12H,10-11H2,1-3H3,(H,21,23)/b20-13- |
| InChIKey | OGAZMWQIUWZRHO-MOSHPQCFSA-N |
| XLogP | 2.01 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|