C18H19BrN2OS — CID 126124192
(2R)-N-[(Z)-1-(3-bromophenyl)ethylideneamino]-2-(4-methylphenyl)sulfanylpropanamide (PubChem CID 126124192) has the molecular formula C18H19BrN2OS and a molecular weight of 391.33 g/mol. Its IUPAC name is (2R)-N-[(Z)-1-(3-bromophenyl)ethylideneamino]-2-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | (2R)-N-[(Z)-1-(3-bromophenyl)ethylideneamino]-2-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 126124192 |
| Molecular Formula | C18H19BrN2OS |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | (2R)-N-[(Z)-1-(3-bromophenyl)ethylideneamino]-2-(4-methylphenyl)sulfanylpropanamide |
| SMILES | C/C(=N/NC(=O)[C@@H](C)Sc1ccc(C)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H19BrN2OS/c1-12-7-9-17(10-8-12)23-14(3)18(22)21-20-13(2)15-5-4-6-16(19)11-15/h4-11,14H,1-3H3,(H,21,22)/b20-13-/t14-/m1/s1 |
| InChIKey | PGUNBEDYQJMLCR-KELUXRKGSA-N |
| XLogP | 4.78 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|