C19H20N2O3S — CID 6967321
(2R)-N-[(Z)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-2-phenylsulfanylpropanamide (PubChem CID 6967321) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is (2R)-N-[(Z)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-2-phenylsulfanylpropanamide.
| Compound Name | (2R)-N-[(Z)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 6967321 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (2R)-N-[(Z)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]-2-phenylsulfanylpropanamide |
| SMILES | C/C(=N/NC(=O)[C@@H](C)Sc1ccccc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H20N2O3S/c1-13(15-8-9-17-18(12-15)24-11-10-23-17)20-21-19(22)14(2)25-16-6-4-3-5-7-16/h3-9,12,14H,10-11H2,1-2H3,(H,21,22)/b20-13-/t14-/m1/s1 |
| InChIKey | ZMQADAFXZCVAAO-KELUXRKGSA-N |
| XLogP | 3.48 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|