C19H19ClN2O3S — CID 3108759
3-(4-chlorophenyl)sulfanyl-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]propanamide (PubChem CID 3108759) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]propanamide |
|---|---|
| PubChem CID | 3108759 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]propanamide |
| SMILES | CC(=NNC(=O)CCSc1ccc(Cl)cc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H19ClN2O3S/c1-13(14-2-7-17-18(12-14)25-10-9-24-17)21-22-19(23)8-11-26-16-5-3-15(20)4-6-16/h2-7,12H,8-11H2,1H3,(H,22,23) |
| InChIKey | KDMSPYYRLQWXMW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|