C17H16Cl2N2O2 — CID 19060154
1-(2,6-dichlorophenyl)-N-[(E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]methanamine (PubChem CID 19060154) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-[(E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]methanamine.
| Compound Name | 1-(2,6-dichlorophenyl)-N-[(E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]methanamine |
|---|---|
| PubChem CID | 19060154 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-[(E)-1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylideneamino]methanamine |
| SMILES | C/C(=N\NCc1c(Cl)cccc1Cl)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H16Cl2N2O2/c1-11(12-5-6-16-17(9-12)23-8-7-22-16)21-20-10-13-14(18)3-2-4-15(13)19/h2-6,9,20H,7-8,10H2,1H3/b21-11+ |
| InChIKey | VOCODQYIQGBJIL-SRZZPIQSSA-N |
| XLogP | 4.28 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|