C28H30N4O6S — CID 126126887
4-[methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide (PubChem CID 126126887) has the molecular formula C28H30N4O6S and a molecular weight of 550.64 g/mol. Its IUPAC name is 4-[methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide.
| Compound Name | 4-[methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126126887 |
| Molecular Formula | C28H30N4O6S |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 4-[methyl-(4-methylphenyl)sulfonylamino]-N-[(Z)-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)N/N=C\c3ccc(OCC(=O)N4CCOCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H30N4O6S/c1-21-3-13-26(14-4-21)39(35,36)31(2)24-9-7-23(8-10-24)28(34)30-29-19-22-5-11-25(12-6-22)38-20-27(33)32-15-17-37-18-16-32/h3-14,19H,15-18,20H2,1-2H3,(H,30,34)/b29-19- |
| InChIKey | UJCILUDJHBFANF-CEUNXORHSA-N |
| XLogP | 2.82 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|