C40H38N4O4S — CID 126128319
(2E,5S)-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-2-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126128319) has the molecular formula C40H38N4O4S and a molecular weight of 670.84 g/mol. Its IUPAC name is (2E,5S)-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-2-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2E,5S)-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-2-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126128319 |
| Molecular Formula | C40H38N4O4S |
| Molecular Weight | 670.84 g/mol |
| Exact Mass | 670.26 |
| IUPAC Name | (2E,5S)-5-(2,5-dimethoxyphenyl)-N,N-diethyl-7-methyl-2-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1=C(C)N=c2s/c(=C/c3cn(Cc4cccc5ccccc45)c4ccccc34)c(=O)n2[C@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C40H38N4O4S/c1-6-42(7-2)39(46)36-25(3)41-40-44(37(36)32-22-29(47-4)19-20-34(32)48-5)38(45)35(49-40)21-28-24-43(33-18-11-10-17-31(28)33)23-27-15-12-14-26-13-8-9-16-30(26)27/h8-22,24,37H,6-7,23H2,1-5H3/b35-21+/t37-/m0/s1 |
| InChIKey | ZQBHPCOTDDGACU-ZJKBLPEWSA-N |
| XLogP | 6.28 |
| TPSA | 78.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.84 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |