C28H20ClN3O4S2 — CID 126132416
(5Z)-3-(2-chlorophenyl)-5-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126132416) has the molecular formula C28H20ClN3O4S2 and a molecular weight of 562.07 g/mol. Its IUPAC name is (5Z)-3-(2-chlorophenyl)-5-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(2-chlorophenyl)-5-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126132416 |
| Molecular Formula | C28H20ClN3O4S2 |
| Molecular Weight | 562.07 g/mol |
| Exact Mass | 561.06 |
| IUPAC Name | (5Z)-3-(2-chlorophenyl)-5-[[2,5-dimethyl-1-[4-(4-nitrophenyl)sulfanylphenyl]pyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(/C=C2\SC(=O)N(c3ccccc3Cl)C2=O)c(C)n1-c1ccc(Sc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C28H20ClN3O4S2/c1-17-15-19(16-26-27(33)31(28(34)38-26)25-6-4-3-5-24(25)29)18(2)30(17)20-7-11-22(12-8-20)37-23-13-9-21(10-14-23)32(35)36/h3-16H,1-2H3/b26-16- |
| InChIKey | ATURJPJNDLBTFD-QQXSKIMKSA-N |
| XLogP | 8.05 |
| TPSA | 85.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.07 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|