C19H19ClN2O3S — CID 126149627
(5Z)-3-(2-chlorophenyl)-5-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126149627) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is (5Z)-3-(2-chlorophenyl)-5-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-(2-chlorophenyl)-5-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126149627 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (5Z)-3-(2-chlorophenyl)-5-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COCCn1c(C)cc(/C=C2\SC(=O)N(c3ccccc3Cl)C2=O)c1C |
| InChI | InChI=1S/C19H19ClN2O3S/c1-12-10-14(13(2)21(12)8-9-25-3)11-17-18(23)22(19(24)26-17)16-7-5-4-6-15(16)20/h4-7,10-11H,8-9H2,1-3H3/b17-11- |
| InChIKey | LVJDBWJJHJZISU-BOPFTXTBSA-N |
| XLogP | 4.65 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|