C22H28N4O3S — CID 126134361
4-[(2-methylphenyl)methyl-methylsulfonylamino]-N-[(1-methylpiperidin-4-ylidene)amino]benzamide (PubChem CID 126134361) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is 4-[(2-methylphenyl)methyl-methylsulfonylamino]-N-[(1-methylpiperidin-4-ylidene)amino]benzamide.
| Compound Name | 4-[(2-methylphenyl)methyl-methylsulfonylamino]-N-[(1-methylpiperidin-4-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 126134361 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 4-[(2-methylphenyl)methyl-methylsulfonylamino]-N-[(1-methylpiperidin-4-ylidene)amino]benzamide |
| SMILES | Cc1ccccc1CN(c1ccc(C(=O)NN=C2CCN(C)CC2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H28N4O3S/c1-17-6-4-5-7-19(17)16-26(30(3,28)29)21-10-8-18(9-11-21)22(27)24-23-20-12-14-25(2)15-13-20/h4-11H,12-16H2,1-3H3,(H,24,27) |
| InChIKey | DKTDOSSSCJPEGX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|