C20H19BrN2O2S — CID 126134709
(5Z)-3-[(4-bromophenyl)methyl]-5-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126134709) has the molecular formula C20H19BrN2O2S and a molecular weight of 431.36 g/mol. Its IUPAC name is (5Z)-3-[(4-bromophenyl)methyl]-5-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(4-bromophenyl)methyl]-5-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126134709 |
| Molecular Formula | C20H19BrN2O2S |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | (5Z)-3-[(4-bromophenyl)methyl]-5-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(/C=C2\SC(=O)N(Cc3ccc(Br)cc3)C2=O)c(C)n1C1CC1 |
| InChI | InChI=1S/C20H19BrN2O2S/c1-12-9-15(13(2)23(12)17-7-8-17)10-18-19(24)22(20(25)26-18)11-14-3-5-16(21)6-4-14/h3-6,9-10,17H,7-8,11H2,1-2H3/b18-10- |
| InChIKey | DUAATARYVJEVIW-ZDLGFXPLSA-N |
| XLogP | 5.44 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|