C18H20N2O2S — CID 126149304
(5Z)-5-[(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione (PubChem CID 126149304) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is (5Z)-5-[(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126149304 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (5Z)-5-[(1-cyclopentyl-2,5-dimethylpyrrol-3-yl)methylidene]-3-prop-2-ynyl-1,3-thiazolidine-2,4-dione |
| SMILES | C#CCN1C(=O)S/C(=C\c2cc(C)n(C3CCCC3)c2C)C1=O |
| InChI | InChI=1S/C18H20N2O2S/c1-4-9-19-17(21)16(23-18(19)22)11-14-10-12(2)20(13(14)3)15-7-5-6-8-15/h1,10-11,15H,5-9H2,2-3H3/b16-11- |
| InChIKey | MPHRHHHSPRSFEZ-WJDWOHSUSA-N |
| XLogP | 3.89 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|