C21H25N3O4S — CID 126134836
2-[[2-(2,3-dimethyl-N-methylsulfonylanilino)acetyl]amino]-N-prop-2-enylbenzamide (PubChem CID 126134836) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-[[2-(2,3-dimethyl-N-methylsulfonylanilino)acetyl]amino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[[2-(2,3-dimethyl-N-methylsulfonylanilino)acetyl]amino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 126134836 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 2-[[2-(2,3-dimethyl-N-methylsulfonylanilino)acetyl]amino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)CN(c1cccc(C)c1C)S(C)(=O)=O |
| InChI | InChI=1S/C21H25N3O4S/c1-5-13-22-21(26)17-10-6-7-11-18(17)23-20(25)14-24(29(4,27)28)19-12-8-9-15(2)16(19)3/h5-12H,1,13-14H2,2-4H3,(H,22,26)(H,23,25) |
| InChIKey | FIVNCZVAJUTPGP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|