C24H33N3O4S — CID 100512833
N-tert-butyl-2-[4-(2,3-dimethyl-N-methylsulfonylanilino)butanoylamino]benzamide (PubChem CID 100512833) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(2,3-dimethyl-N-methylsulfonylanilino)butanoylamino]benzamide.
| Compound Name | N-tert-butyl-2-[4-(2,3-dimethyl-N-methylsulfonylanilino)butanoylamino]benzamide |
|---|---|
| PubChem CID | 100512833 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-tert-butyl-2-[4-(2,3-dimethyl-N-methylsulfonylanilino)butanoylamino]benzamide |
| SMILES | Cc1cccc(N(CCCC(=O)Nc2ccccc2C(=O)NC(C)(C)C)S(C)(=O)=O)c1C |
| InChI | InChI=1S/C24H33N3O4S/c1-17-11-9-14-21(18(17)2)27(32(6,30)31)16-10-15-22(28)25-20-13-8-7-12-19(20)23(29)26-24(3,4)5/h7-9,11-14H,10,15-16H2,1-6H3,(H,25,28)(H,26,29) |
| InChIKey | KNLUJGNEBHAIOC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |