C26H27BrN2O6S — CID 126136631
(5E)-5-[[2-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126136631) has the molecular formula C26H27BrN2O6S and a molecular weight of 575.48 g/mol. Its IUPAC name is (5E)-5-[[2-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126136631 |
| Molecular Formula | C26H27BrN2O6S |
| Molecular Weight | 575.48 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | (5E)-5-[[2-bromo-5-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-(2-morpholin-4-yl-2-oxoethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N(CC(=O)N3CCOCC3)C2=O)c(Br)cc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C26H27BrN2O6S/c1-3-34-21-12-19(20(27)14-22(21)35-16-18-6-4-5-17(2)11-18)13-23-25(31)29(26(32)36-23)15-24(30)28-7-9-33-10-8-28/h4-6,11-14H,3,7-10,15-16H2,1-2H3/b23-13+ |
| InChIKey | LKKZGGNLXIDIOT-YDZHTSKRSA-N |
| XLogP | 4.63 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|