C6H8Cl4O2 — CID 12613756
1,1,1-trichloropropan-2-yl 2-chloropropanoate (PubChem CID 12613756) has the molecular formula C6H8Cl4O2 and a molecular weight of 253.94 g/mol. Its IUPAC name is 1,1,1-trichloropropan-2-yl 2-chloropropanoate.
| Compound Name | 1,1,1-trichloropropan-2-yl 2-chloropropanoate |
|---|---|
| PubChem CID | 12613756 |
| Molecular Formula | C6H8Cl4O2 |
| Molecular Weight | 253.94 g/mol |
| Exact Mass | 251.93 |
| IUPAC Name | 1,1,1-trichloropropan-2-yl 2-chloropropanoate |
| SMILES | CC(Cl)C(=O)OC(C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H8Cl4O2/c1-3(7)5(11)12-4(2)6(8,9)10/h3-4H,1-2H3 |
| InChIKey | WMNBUWLWPDCLRO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.94 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|