C29H23BrN2O3S — CID 126141559
(5Z)-5-[[1-(4-bromonaphthalen-1-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126141559) has the molecular formula C29H23BrN2O3S and a molecular weight of 559.49 g/mol. Its IUPAC name is (5Z)-5-[[1-(4-bromonaphthalen-1-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-(4-bromonaphthalen-1-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126141559 |
| Molecular Formula | C29H23BrN2O3S |
| Molecular Weight | 559.49 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | (5Z)-5-[[1-(4-bromonaphthalen-1-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(C(=O)CN2C(=O)S/C(=C\c3cc(C)n(-c4ccc(Br)c5ccccc45)c3C)C2=O)cc1 |
| InChI | InChI=1S/C29H23BrN2O3S/c1-17-8-10-20(11-9-17)26(33)16-31-28(34)27(36-29(31)35)15-21-14-18(2)32(19(21)3)25-13-12-24(30)22-6-4-5-7-23(22)25/h4-15H,16H2,1-3H3/b27-15- |
| InChIKey | UCTSKFZUBONVKL-DICXZTSXSA-N |
| XLogP | 7.24 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.49 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|