C21H17BrCl2N2O4 — CID 126144447
(5E)-5-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione (PubChem CID 126144447) has the molecular formula C21H17BrCl2N2O4 and a molecular weight of 512.19 g/mol. Its IUPAC name is (5E)-5-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126144447 |
| Molecular Formula | C21H17BrCl2N2O4 |
| Molecular Weight | 512.19 g/mol |
| Exact Mass | 509.97 |
| IUPAC Name | (5E)-5-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)N/C(=C/c2cc(OC)c(OCc3ccc(Cl)c(Cl)c3)cc2Br)C1=O |
| InChI | InChI=1S/C21H17BrCl2N2O4/c1-3-6-26-20(27)17(25-21(26)28)8-13-9-18(29-2)19(10-14(13)22)30-11-12-4-5-15(23)16(24)7-12/h3-5,7-10H,1,6,11H2,2H3,(H,25,28)/b17-8+ |
| InChIKey | YKQDLYSKSAKIEW-CAOOACKPSA-N |
| XLogP | 5.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.19 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|