C19H16BrClN2O4 — CID 126149746
[2-(4-bromoanilino)-2-oxoethyl] (3R)-1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 126149746) has the molecular formula C19H16BrClN2O4 and a molecular weight of 451.70 g/mol. Its IUPAC name is [2-(4-bromoanilino)-2-oxoethyl] (3R)-1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(4-bromoanilino)-2-oxoethyl] (3R)-1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 126149746 |
| Molecular Formula | C19H16BrClN2O4 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | [2-(4-bromoanilino)-2-oxoethyl] (3R)-1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)[C@@H]1CC(=O)N(c2cccc(Cl)c2)C1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H16BrClN2O4/c20-13-4-6-15(7-5-13)22-17(24)11-27-19(26)12-8-18(25)23(10-12)16-3-1-2-14(21)9-16/h1-7,9,12H,8,10-11H2,(H,22,24)/t12-/m1/s1 |
| InChIKey | NICNEIRODIGZJB-GFCCVEGCSA-N |
| XLogP | 3.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |