C20H19ClN2O5 — CID 38112621
[2-(2-methoxyanilino)-2-oxoethyl] (3S)-1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 38112621) has the molecular formula C20H19ClN2O5 and a molecular weight of 402.83 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] (3S)-1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl] (3S)-1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 38112621 |
| Molecular Formula | C20H19ClN2O5 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] (3S)-1-(3-chlorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccccc1NC(=O)COC(=O)[C@H]1CC(=O)N(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H19ClN2O5/c1-27-17-8-3-2-7-16(17)22-18(24)12-28-20(26)13-9-19(25)23(11-13)15-6-4-5-14(21)10-15/h2-8,10,13H,9,11-12H2,1H3,(H,22,24)/t13-/m0/s1 |
| InChIKey | YDPIRSBMZWJONP-ZDUSSCGKSA-N |
| XLogP | 2.88 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |