C21H25N3O7S — CID 126150068
2-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[(Z)-(3-methoxy-4-prop-2-enoxyphenyl)methylideneamino]acetamide (PubChem CID 126150068) has the molecular formula C21H25N3O7S and a molecular weight of 463.51 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[(Z)-(3-methoxy-4-prop-2-enoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[(Z)-(3-methoxy-4-prop-2-enoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126150068 |
| Molecular Formula | C21H25N3O7S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[(Z)-(3-methoxy-4-prop-2-enoxyphenyl)methylideneamino]acetamide |
| SMILES | C=CCOc1ccc(/C=N\NC(=O)CNS(=O)(=O)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H25N3O7S/c1-5-10-31-18-8-6-15(11-19(18)29-3)13-22-24-21(25)14-23-32(26,27)16-7-9-17(28-2)20(12-16)30-4/h5-9,11-13,23H,1,10,14H2,2-4H3,(H,24,25)/b22-13- |
| InChIKey | HUNNLIINQVUPPG-XKZIYDEJSA-N |
| XLogP | 1.71 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|