C18H26N3O3+ — CID 7330106
N-[(Z)-(3-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-piperidin-1-ium-1-ylacetamide (PubChem CID 7330106) has the molecular formula C18H26N3O3+ and a molecular weight of 332.42 g/mol. Its IUPAC name is N-[(Z)-(3-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-piperidin-1-ium-1-ylacetamide.
| Compound Name | N-[(Z)-(3-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-piperidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 7330106 |
| Molecular Formula | C18H26N3O3+ |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | N-[(Z)-(3-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-piperidin-1-ium-1-ylacetamide |
| SMILES | C=CCOc1ccc(/C=N\NC(=O)C[NH+]2CCCCC2)cc1OC |
| InChI | InChI=1S/C18H25N3O3/c1-3-11-24-16-8-7-15(12-17(16)23-2)13-19-20-18(22)14-21-9-5-4-6-10-21/h3,7-8,12-13H,1,4-6,9-11,14H2,2H3,(H,20,22)/p+1/b19-13- |
| InChIKey | CJMPKOBKQIVARG-UYRXBGFRSA-O |
| XLogP | 0.78 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|