C17H24N3O3+ — CID 135619151
N-[(E)-(2-hydroxy-4-prop-2-enoxyphenyl)methylideneamino]-2-piperidin-1-ium-1-ylacetamide (PubChem CID 135619151) has the molecular formula C17H24N3O3+ and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-4-prop-2-enoxyphenyl)methylideneamino]-2-piperidin-1-ium-1-ylacetamide.
| Compound Name | N-[(E)-(2-hydroxy-4-prop-2-enoxyphenyl)methylideneamino]-2-piperidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 135619151 |
| Molecular Formula | C17H24N3O3+ |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | N-[(E)-(2-hydroxy-4-prop-2-enoxyphenyl)methylideneamino]-2-piperidin-1-ium-1-ylacetamide |
| SMILES | C=CCOc1ccc(/C=N/NC(=O)C[NH+]2CCCCC2)c(O)c1 |
| InChI | InChI=1S/C17H23N3O3/c1-2-10-23-15-7-6-14(16(21)11-15)12-18-19-17(22)13-20-8-4-3-5-9-20/h2,6-7,11-12,21H,1,3-5,8-10,13H2,(H,19,22)/p+1/b18-12+ |
| InChIKey | JBXYXQCCKKDQAX-LDADJPATSA-O |
| XLogP | 0.48 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|