C13H16Br2N3O2+ — CID 135619495
N-[(E)-(3,6-dibromo-2-hydroxyphenyl)methylideneamino]-2-pyrrolidin-1-ium-1-ylacetamide (PubChem CID 135619495) has the molecular formula C13H16Br2N3O2+ and a molecular weight of 406.10 g/mol. Its IUPAC name is N-[(E)-(3,6-dibromo-2-hydroxyphenyl)methylideneamino]-2-pyrrolidin-1-ium-1-ylacetamide.
| Compound Name | N-[(E)-(3,6-dibromo-2-hydroxyphenyl)methylideneamino]-2-pyrrolidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 135619495 |
| Molecular Formula | C13H16Br2N3O2+ |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | N-[(E)-(3,6-dibromo-2-hydroxyphenyl)methylideneamino]-2-pyrrolidin-1-ium-1-ylacetamide |
| SMILES | O=C(C[NH+]1CCCC1)N/N=C/c1c(Br)ccc(Br)c1O |
| InChI | InChI=1S/C13H15Br2N3O2/c14-10-3-4-11(15)13(20)9(10)7-16-17-12(19)8-18-5-1-2-6-18/h3-4,7,20H,1-2,5-6,8H2,(H,17,19)/p+1/b16-7+ |
| InChIKey | BVBAXKFCISXWRY-FRKPEAEDSA-O |
| XLogP | 1.05 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|