C16H23N5O+2 — CID 135852319
N-[(E)-1H-indol-3-ylmethylideneamino]-2-(4-methylpiperazine-1,4-diium-1-yl)acetamide (PubChem CID 135852319) has the molecular formula C16H23N5O+2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[(E)-1H-indol-3-ylmethylideneamino]-2-(4-methylpiperazine-1,4-diium-1-yl)acetamide.
| Compound Name | N-[(E)-1H-indol-3-ylmethylideneamino]-2-(4-methylpiperazine-1,4-diium-1-yl)acetamide |
|---|---|
| PubChem CID | 135852319 |
| Molecular Formula | C16H23N5O+2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | N-[(E)-1H-indol-3-ylmethylideneamino]-2-(4-methylpiperazine-1,4-diium-1-yl)acetamide |
| SMILES | C[NH+]1CC[NH+](CC(=O)N/N=C/c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C16H21N5O/c1-20-6-8-21(9-7-20)12-16(22)19-18-11-13-10-17-15-5-3-2-4-14(13)15/h2-5,10-11,17H,6-9,12H2,1H3,(H,19,22)/p+2/b18-11+ |
| InChIKey | UDIKBQBJXBZMFC-WOJGMQOQSA-P |
| XLogP | -1.97 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|