C15H22N3O3+ — CID 135606927
N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-piperidin-1-ium-1-ylacetamide (PubChem CID 135606927) has the molecular formula C15H22N3O3+ and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-piperidin-1-ium-1-ylacetamide.
| Compound Name | N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-piperidin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 135606927 |
| Molecular Formula | C15H22N3O3+ |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-piperidin-1-ium-1-ylacetamide |
| SMILES | COc1cc(/C=N/NC(=O)C[NH+]2CCCCC2)ccc1O |
| InChI | InChI=1S/C15H21N3O3/c1-21-14-9-12(5-6-13(14)19)10-16-17-15(20)11-18-7-3-2-4-8-18/h5-6,9-10,19H,2-4,7-8,11H2,1H3,(H,17,20)/p+1/b16-10+ |
| InChIKey | TZEFOTQBMFTBJY-MHWRWJLKSA-O |
| XLogP | -0.08 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|