C20H24FN4O3+ — CID 135748100
2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 135748100) has the molecular formula C20H24FN4O3+ and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135748100 |
| Molecular Formula | C20H24FN4O3+ |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[4-(4-fluorophenyl)piperazin-1-ium-1-yl]-N-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)C[NH+]2CCN(c3ccc(F)cc3)CC2)ccc1O |
| InChI | InChI=1S/C20H23FN4O3/c1-28-19-12-15(2-7-18(19)26)13-22-23-20(27)14-24-8-10-25(11-9-24)17-5-3-16(21)4-6-17/h2-7,12-13,26H,8-11,14H2,1H3,(H,23,27)/p+1/b22-13+ |
| InChIKey | LWKFROGLOGOBFK-LPYMAVHISA-O |
| XLogP | 0.40 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|