C19H20N2O3S — CID 137077971
(2R)-N-[(Z)-(2-hydroxy-4-prop-2-enoxyphenyl)methylideneamino]-2-phenylsulfanylpropanamide (PubChem CID 137077971) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is (2R)-N-[(Z)-(2-hydroxy-4-prop-2-enoxyphenyl)methylideneamino]-2-phenylsulfanylpropanamide.
| Compound Name | (2R)-N-[(Z)-(2-hydroxy-4-prop-2-enoxyphenyl)methylideneamino]-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 137077971 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (2R)-N-[(Z)-(2-hydroxy-4-prop-2-enoxyphenyl)methylideneamino]-2-phenylsulfanylpropanamide |
| SMILES | C=CCOc1ccc(/C=N\NC(=O)[C@@H](C)Sc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C19H20N2O3S/c1-3-11-24-16-10-9-15(18(22)12-16)13-20-21-19(23)14(2)25-17-7-5-4-6-8-17/h3-10,12-14,22H,1,11H2,2H3,(H,21,23)/b20-13-/t14-/m1/s1 |
| InChIKey | ANVZIKNDISFNQI-KELUXRKGSA-N |
| XLogP | 3.59 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|